C26H35N3O3S — CID 142011984
tert-butyl N-[4-[2-cyanoethyl-(4-methoxyphenyl)sulfanylamino]-3-methyl-1-phenylbutan-2-yl]carbamate (PubChem CID 142011984) has the molecular formula C26H35N3O3S and a molecular weight of 469.65 g/mol. Its IUPAC name is tert-butyl N-[4-[2-cyanoethyl-(4-methoxyphenyl)sulfanylamino]-3-methyl-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[2-cyanoethyl-(4-methoxyphenyl)sulfanylamino]-3-methyl-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 142011984 |
| Molecular Formula | C26H35N3O3S |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | tert-butyl N-[4-[2-cyanoethyl-(4-methoxyphenyl)sulfanylamino]-3-methyl-1-phenylbutan-2-yl]carbamate |
| SMILES | COc1ccc(SN(CCC#N)CC(C)C(Cc2ccccc2)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C26H35N3O3S/c1-20(19-29(17-9-16-27)33-23-14-12-22(31-5)13-15-23)24(18-21-10-7-6-8-11-21)28-25(30)32-26(2,3)4/h6-8,10-15,20,24H,9,17-19H2,1-5H3,(H,28,30) |
| InChIKey | DGHVDZZYDWSCQC-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|