C27H33N3O6S — CID 59973763
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-[2-cyanoethyl-(4-methoxyphenyl)sulfanylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 59973763) has the molecular formula C27H33N3O6S and a molecular weight of 527.64 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-[2-cyanoethyl-(4-methoxyphenyl)sulfanylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-[2-cyanoethyl-(4-methoxyphenyl)sulfanylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 59973763 |
| Molecular Formula | C27H33N3O6S |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-[2-cyanoethyl-(4-methoxyphenyl)sulfanylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | COc1ccc(SN(CCC#N)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CO[C@H]3OCC[C@H]32)cc1 |
| InChI | InChI=1S/C27H33N3O6S/c1-33-20-8-10-21(11-9-20)37-30(14-5-13-28)17-24(31)23(16-19-6-3-2-4-7-19)29-27(32)36-25-18-35-26-22(25)12-15-34-26/h2-4,6-11,22-26,31H,5,12,14-18H2,1H3,(H,29,32)/t22-,23-,24+,25-,26+/m0/s1 |
| InChIKey | XVYRSZQYXZEJBA-HEXNFIEUSA-N |
| XLogP | 3.38 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|