C28H35N3O5S2 — CID 91320741
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[1,3-benzothiazol-6-ylsulfanyl(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 91320741) has the molecular formula C28H35N3O5S2 and a molecular weight of 557.74 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[1,3-benzothiazol-6-ylsulfanyl(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[1,3-benzothiazol-6-ylsulfanyl(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 91320741 |
| Molecular Formula | C28H35N3O5S2 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[1,3-benzothiazol-6-ylsulfanyl(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)CN(CC(O)C(Cc1ccccc1)NC(=O)OC1COC2OCCC12)Sc1ccc2ncsc2c1 |
| InChI | InChI=1S/C28H35N3O5S2/c1-18(2)14-31(38-20-8-9-22-26(13-20)37-17-29-22)15-24(32)23(12-19-6-4-3-5-7-19)30-28(33)36-25-16-35-27-21(25)10-11-34-27/h3-9,13,17-18,21,23-25,27,32H,10-12,14-16H2,1-2H3,(H,30,33) |
| InChIKey | GPLVCFDWOILJFC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|