C34H45N3O8S — CID 91615033
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[3-[[ethoxymethyl(formyl)amino]methyl]-1-benzofuran-5-yl]sulfanyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 91615033) has the molecular formula C34H45N3O8S and a molecular weight of 655.81 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[3-[[ethoxymethyl(formyl)amino]methyl]-1-benzofuran-5-yl]sulfanyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[3-[[ethoxymethyl(formyl)amino]methyl]-1-benzofuran-5-yl]sulfanyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 91615033 |
| Molecular Formula | C34H45N3O8S |
| Molecular Weight | 655.81 g/mol |
| Exact Mass | 655.29 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[3-[[ethoxymethyl(formyl)amino]methyl]-1-benzofuran-5-yl]sulfanyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CCOCN(C=O)Cc1coc2ccc(SN(CC(C)C)CC(O)C(Cc3ccccc3)NC(=O)OC3COC4OCCC34)cc12 |
| InChI | InChI=1S/C34H45N3O8S/c1-4-41-22-36(21-38)17-25-19-43-31-11-10-26(15-28(25)31)46-37(16-23(2)3)18-30(39)29(14-24-8-6-5-7-9-24)35-34(40)45-32-20-44-33-27(32)12-13-42-33/h5-11,15,19,21,23,27,29-30,32-33,39H,4,12-14,16-18,20,22H2,1-3H3,(H,35,40) |
| InChIKey | VGBWAEQETUHFDH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 122.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.81 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|