C29H40N2O6S — CID 123345139
3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-4-yl N-[3-hydroxy-4-[(4-methoxyphenyl)sulfanyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate (PubChem CID 123345139) has the molecular formula C29H40N2O6S and a molecular weight of 544.71 g/mol. Its IUPAC name is 3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-4-yl N-[3-hydroxy-4-[(4-methoxyphenyl)sulfanyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | 3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-4-yl N-[3-hydroxy-4-[(4-methoxyphenyl)sulfanyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 123345139 |
| Molecular Formula | C29H40N2O6S |
| Molecular Weight | 544.71 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | 3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-4-yl N-[3-hydroxy-4-[(4-methoxyphenyl)sulfanyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate |
| SMILES | COc1ccc(SN(CC(C)C)CC(O)C(Cc2ccccc2)NC(=O)OC2CCOC3OCCC23)cc1 |
| InChI | InChI=1S/C29H40N2O6S/c1-20(2)18-31(38-23-11-9-22(34-3)10-12-23)19-26(32)25(17-21-7-5-4-6-8-21)30-29(33)37-27-14-16-36-28-24(27)13-15-35-28/h4-12,20,24-28,32H,13-19H2,1-3H3,(H,30,33) |
| InChIKey | QPATUWZUJFWSBE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.71 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|