C34H35N3O3S — CID 59094269
cis-(1R,2S)-N-[(8R)-8-[(4-methylphenyl)sulfonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]-N-[(6-methyl-2-pyridinyl)methyl]-2-phenylcyclopropane-1-carboxamide (PubChem CID 59094269) has the molecular formula C34H35N3O3S and a molecular weight of 565.74 g/mol. Its IUPAC name is cis-(1R,2S)-N-[(8R)-8-[(4-methylphenyl)sulfonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]-N-[(6-methyl-2-pyridinyl)methyl]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-[(8R)-8-[(4-methylphenyl)sulfonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]-N-[(6-methyl-2-pyridinyl)methyl]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 59094269 |
| Molecular Formula | C34H35N3O3S |
| Molecular Weight | 565.74 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | cis-(1R,2S)-N-[(8R)-8-[(4-methylphenyl)sulfonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]-N-[(6-methyl-2-pyridinyl)methyl]-2-phenylcyclopropane-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2CCCc3ccc(N(Cc4cccc(C)n4)C(=O)[C@@H]4C[C@@H]4c4ccccc4)cc32)cc1 |
| InChI | InChI=1S/C34H35N3O3S/c1-23-14-18-29(19-15-23)41(39,40)36-33-13-7-11-26-16-17-28(20-31(26)33)37(22-27-12-6-8-24(2)35-27)34(38)32-21-30(32)25-9-4-3-5-10-25/h3-6,8-10,12,14-20,30,32-33,36H,7,11,13,21-22H2,1-2H3/t30-,32-,33-/m1/s1 |
| InChIKey | DIQATOLNAWWNSD-JORIVFIJSA-N |
| XLogP | 6.39 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.74 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |