C33H33N3O3S — CID 59094245
cis-(1R,2S)-N-[8-(benzenesulfonamido)-5,6,7,8-tetrahydronaphthalen-2-yl]-N-[(6-methyl-2-pyridinyl)methyl]-2-phenylcyclopropane-1-carboxamide (PubChem CID 59094245) has the molecular formula C33H33N3O3S and a molecular weight of 551.71 g/mol. Its IUPAC name is cis-(1R,2S)-N-[8-(benzenesulfonamido)-5,6,7,8-tetrahydronaphthalen-2-yl]-N-[(6-methyl-2-pyridinyl)methyl]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-[8-(benzenesulfonamido)-5,6,7,8-tetrahydronaphthalen-2-yl]-N-[(6-methyl-2-pyridinyl)methyl]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 59094245 |
| Molecular Formula | C33H33N3O3S |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | cis-(1R,2S)-N-[8-(benzenesulfonamido)-5,6,7,8-tetrahydronaphthalen-2-yl]-N-[(6-methyl-2-pyridinyl)methyl]-2-phenylcyclopropane-1-carboxamide |
| SMILES | Cc1cccc(CN(C(=O)[C@@H]2C[C@@H]2c2ccccc2)c2ccc3c(c2)C(NS(=O)(=O)c2ccccc2)CCC3)n1 |
| InChI | InChI=1S/C33H33N3O3S/c1-23-10-8-14-26(34-23)22-36(33(37)31-21-29(31)24-11-4-2-5-12-24)27-19-18-25-13-9-17-32(30(25)20-27)35-40(38,39)28-15-6-3-7-16-28/h2-8,10-12,14-16,18-20,29,31-32,35H,9,13,17,21-22H2,1H3/t29-,31-,32?/m1/s1 |
| InChIKey | YJRMPKXNVWUSSV-KVZOJTFESA-N |
| XLogP | 6.08 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |