C26H48O9Si — CID 59094710
[(2S,3S,4E)-2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-6-[(2R,3R)-2,3-dihydroxybutyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)oxan-3-yl] propanoate (PubChem CID 59094710) has the molecular formula C26H48O9Si and a molecular weight of 532.75 g/mol. Its IUPAC name is [(2S,3S,4E)-2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-6-[(2R,3R)-2,3-dihydroxybutyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)oxan-3-yl] propanoate.
| Compound Name | [(2S,3S,4E)-2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-6-[(2R,3R)-2,3-dihydroxybutyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)oxan-3-yl] propanoate |
|---|---|
| PubChem CID | 59094710 |
| Molecular Formula | C26H48O9Si |
| Molecular Weight | 532.75 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | [(2S,3S,4E)-2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-6-[(2R,3R)-2,3-dihydroxybutyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)oxan-3-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1/C(=C/C(=O)OC)CC(C[C@@H](O)[C@@H](C)O)O[C@@]1(OC)C(C)(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H48O9Si/c1-12-21(29)34-23-18(14-22(30)31-8)13-19(15-20(28)17(2)27)35-26(23,32-9)25(6,7)16-33-36(10,11)24(3,4)5/h14,17,19-20,23,27-28H,12-13,15-16H2,1-11H3/b18-14+/t17-,19?,20-,23+,26-/m1/s1 |
| InChIKey | MZFRSYVWVQNVDM-GPRDFVCPSA-N |
| XLogP | 3.72 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.75 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|