C40H29N3O2 — CID 59096446
(Z)-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)-4-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]but-3-en-2-one (PubChem CID 59096446) has the molecular formula C40H29N3O2 and a molecular weight of 583.69 g/mol. Its IUPAC name is (Z)-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)-4-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]but-3-en-2-one.
| Compound Name | (Z)-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)-4-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 59096446 |
| Molecular Formula | C40H29N3O2 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.23 |
| IUPAC Name | (Z)-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)-4-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]but-3-en-2-one |
| SMILES | CC(=O)/C(=C\c1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccccc3)cc2)cc1)c1nc2ncccc2o1 |
| InChI | InChI=1S/C40H29N3O2/c1-28(44)37(40-42-39-38(45-40)13-8-26-41-39)27-29-14-20-34(21-15-29)43(35-22-16-32(17-23-35)30-9-4-2-5-10-30)36-24-18-33(19-25-36)31-11-6-3-7-12-31/h2-27H,1H3/b37-27+ |
| InChIKey | VKGCVXLTHCMWIN-NXEFEZKASA-N |
| XLogP | 10.16 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|