C34H29N5O3 — CID 59045285
ethyl (Z)-3-[4-(N-[4-(dimethylamino)phenyl]anilino)phenyl]-2-([1,3]oxazolo[4,5-b]quinoxalin-2-yl)prop-2-enoate (PubChem CID 59045285) has the molecular formula C34H29N5O3 and a molecular weight of 555.64 g/mol. Its IUPAC name is ethyl (Z)-3-[4-(N-[4-(dimethylamino)phenyl]anilino)phenyl]-2-([1,3]oxazolo[4,5-b]quinoxalin-2-yl)prop-2-enoate.
| Compound Name | ethyl (Z)-3-[4-(N-[4-(dimethylamino)phenyl]anilino)phenyl]-2-([1,3]oxazolo[4,5-b]quinoxalin-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 59045285 |
| Molecular Formula | C34H29N5O3 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | ethyl (Z)-3-[4-(N-[4-(dimethylamino)phenyl]anilino)phenyl]-2-([1,3]oxazolo[4,5-b]quinoxalin-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C\c1ccc(N(c2ccccc2)c2ccc(N(C)C)cc2)cc1)c1nc2nc3ccccc3nc2o1 |
| InChI | InChI=1S/C34H29N5O3/c1-4-41-34(40)28(32-37-31-33(42-32)36-30-13-9-8-12-29(30)35-31)22-23-14-16-26(17-15-23)39(25-10-6-5-7-11-25)27-20-18-24(19-21-27)38(2)3/h5-22H,4H2,1-3H3/b28-22- |
| InChIKey | IYZZRCNETOXBAV-SLMZUGIISA-N |
| XLogP | 7.41 |
| TPSA | 84.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|