C15H16BrNO3 — CID 59096930
ethyl 3-(4-bromophenyl)-2-(5-methyl-1,2-oxazol-3-yl)propanoate (PubChem CID 59096930) has the molecular formula C15H16BrNO3 and a molecular weight of 338.20 g/mol. Its IUPAC name is ethyl 3-(4-bromophenyl)-2-(5-methyl-1,2-oxazol-3-yl)propanoate.
| Compound Name | ethyl 3-(4-bromophenyl)-2-(5-methyl-1,2-oxazol-3-yl)propanoate |
|---|---|
| PubChem CID | 59096930 |
| Molecular Formula | C15H16BrNO3 |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | ethyl 3-(4-bromophenyl)-2-(5-methyl-1,2-oxazol-3-yl)propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(Br)cc1)c1cc(C)on1 |
| InChI | InChI=1S/C15H16BrNO3/c1-3-19-15(18)13(14-8-10(2)20-17-14)9-11-4-6-12(16)7-5-11/h4-8,13H,3,9H2,1-2H3 |
| InChIKey | WMNDEXSWLDAQCO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |