C30H22F3N3O2 — CID 59099001
1-[(2,4-dimethylphenyl)methyl]-6-[4-(1H-indol-5-yloxy)phenyl]-3-isocyano-4-(trifluoromethyl)pyridin-2-one (PubChem CID 59099001) has the molecular formula C30H22F3N3O2 and a molecular weight of 513.52 g/mol. Its IUPAC name is 1-[(2,4-dimethylphenyl)methyl]-6-[4-(1H-indol-5-yloxy)phenyl]-3-isocyano-4-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[(2,4-dimethylphenyl)methyl]-6-[4-(1H-indol-5-yloxy)phenyl]-3-isocyano-4-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 59099001 |
| Molecular Formula | C30H22F3N3O2 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 1-[(2,4-dimethylphenyl)methyl]-6-[4-(1H-indol-5-yloxy)phenyl]-3-isocyano-4-(trifluoromethyl)pyridin-2-one |
| SMILES | [C-]#[N+]c1c(C(F)(F)F)cc(-c2ccc(Oc3ccc4[nH]ccc4c3)cc2)n(Cc2ccc(C)cc2C)c1=O |
| InChI | InChI=1S/C30H22F3N3O2/c1-18-4-5-22(19(2)14-18)17-36-27(16-25(30(31,32)33)28(34-3)29(36)37)20-6-8-23(9-7-20)38-24-10-11-26-21(15-24)12-13-35-26/h4-16,35H,17H2,1-2H3 |
| InChIKey | FXYFMPUWJFJIRG-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|