C30H24F3N3O3 — CID 88910371
3-[4-[1-[(2,4-dimethylphenyl)methyl]-5-isocyano-6-oxo-4-(trifluoromethyl)-2-pyridinyl]phenoxy]-N-methylbenzamide (PubChem CID 88910371) has the molecular formula C30H24F3N3O3 and a molecular weight of 531.53 g/mol. Its IUPAC name is 3-[4-[1-[(2,4-dimethylphenyl)methyl]-5-isocyano-6-oxo-4-(trifluoromethyl)-2-pyridinyl]phenoxy]-N-methylbenzamide.
| Compound Name | 3-[4-[1-[(2,4-dimethylphenyl)methyl]-5-isocyano-6-oxo-4-(trifluoromethyl)-2-pyridinyl]phenoxy]-N-methylbenzamide |
|---|---|
| PubChem CID | 88910371 |
| Molecular Formula | C30H24F3N3O3 |
| Molecular Weight | 531.53 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 3-[4-[1-[(2,4-dimethylphenyl)methyl]-5-isocyano-6-oxo-4-(trifluoromethyl)-2-pyridinyl]phenoxy]-N-methylbenzamide |
| SMILES | [C-]#[N+]c1c(C(F)(F)F)cc(-c2ccc(Oc3cccc(C(=O)NC)c3)cc2)n(Cc2ccc(C)cc2C)c1=O |
| InChI | InChI=1S/C30H24F3N3O3/c1-18-8-9-22(19(2)14-18)17-36-26(16-25(30(31,32)33)27(34-3)29(36)38)20-10-12-23(13-11-20)39-24-7-5-6-21(15-24)28(37)35-4/h5-16H,17H2,1-2,4H3,(H,35,37) |
| InChIKey | JBGNUMIXVNYPMI-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.53 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|