C28H22F3N3O2 — CID 59726333
6-[4-(3-aminophenoxy)phenyl]-1-[(2,4-dimethylphenyl)methyl]-3-isocyano-4-(trifluoromethyl)pyridin-2-one (PubChem CID 59726333) has the molecular formula C28H22F3N3O2 and a molecular weight of 489.50 g/mol. Its IUPAC name is 6-[4-(3-aminophenoxy)phenyl]-1-[(2,4-dimethylphenyl)methyl]-3-isocyano-4-(trifluoromethyl)pyridin-2-one.
| Compound Name | 6-[4-(3-aminophenoxy)phenyl]-1-[(2,4-dimethylphenyl)methyl]-3-isocyano-4-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 59726333 |
| Molecular Formula | C28H22F3N3O2 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 6-[4-(3-aminophenoxy)phenyl]-1-[(2,4-dimethylphenyl)methyl]-3-isocyano-4-(trifluoromethyl)pyridin-2-one |
| SMILES | [C-]#[N+]c1c(C(F)(F)F)cc(-c2ccc(Oc3cccc(N)c3)cc2)n(Cc2ccc(C)cc2C)c1=O |
| InChI | InChI=1S/C28H22F3N3O2/c1-17-7-8-20(18(2)13-17)16-34-25(15-24(28(29,30)31)26(33-3)27(34)35)19-9-11-22(12-10-19)36-23-6-4-5-21(32)14-23/h4-15H,16,32H2,1-2H3 |
| InChIKey | KNMLEVSVURRRLX-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|