C31H26F3N3O4 — CID 91602465
3-[[4-[5-cyano-1-[(2,4-dimethylphenyl)methyl]-6-oxo-4-(trifluoromethyl)-2-pyridinyl]phenoxy]-methoxymethyl]benzamide (PubChem CID 91602465) has the molecular formula C31H26F3N3O4 and a molecular weight of 561.56 g/mol. Its IUPAC name is 3-[[4-[5-cyano-1-[(2,4-dimethylphenyl)methyl]-6-oxo-4-(trifluoromethyl)-2-pyridinyl]phenoxy]-methoxymethyl]benzamide.
| Compound Name | 3-[[4-[5-cyano-1-[(2,4-dimethylphenyl)methyl]-6-oxo-4-(trifluoromethyl)-2-pyridinyl]phenoxy]-methoxymethyl]benzamide |
|---|---|
| PubChem CID | 91602465 |
| Molecular Formula | C31H26F3N3O4 |
| Molecular Weight | 561.56 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | 3-[[4-[5-cyano-1-[(2,4-dimethylphenyl)methyl]-6-oxo-4-(trifluoromethyl)-2-pyridinyl]phenoxy]-methoxymethyl]benzamide |
| SMILES | COC(Oc1ccc(-c2cc(C(F)(F)F)c(C#N)c(=O)n2Cc2ccc(C)cc2C)cc1)c1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C31H26F3N3O4/c1-18-7-8-23(19(2)13-18)17-37-27(15-26(31(32,33)34)25(16-35)29(37)39)20-9-11-24(12-10-20)41-30(40-3)22-6-4-5-21(14-22)28(36)38/h4-15,30H,17H2,1-3H3,(H2,36,38) |
| InChIKey | QNCSXFPVSZXTJO-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.56 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|