C13H14N3O5S — CID 59099871
CID 59099871 (PubChem CID 59099871) has the molecular formula C13H14N3O5S and a molecular weight of 324.34 g/mol.
| Compound Name | CID 59099871 |
|---|---|
| PubChem CID | 59099871 |
| Molecular Formula | C13H14N3O5S |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | — |
| SMILES | COc1cc(Nc2ccccc2)ccc1N([N]O)S(=O)(=O)O |
| InChI | InChI=1S/C13H14N3O5S/c1-21-13-9-11(14-10-5-3-2-4-6-10)7-8-12(13)16(15-17)22(18,19)20/h2-9,14,17H,1H3,(H,18,19,20) |
| InChIKey | KQMCCMSALWCZAT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 113.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|