C20H20N2O4 — CID 59100938
(2S)-2-[[(1R)-1-carboxy-3-phenylpropyl]amino]-5-pyridin-2-ylpent-4-ynoic acid (PubChem CID 59100938) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is (2S)-2-[[(1R)-1-carboxy-3-phenylpropyl]amino]-5-pyridin-2-ylpent-4-ynoic acid.
| Compound Name | (2S)-2-[[(1R)-1-carboxy-3-phenylpropyl]amino]-5-pyridin-2-ylpent-4-ynoic acid |
|---|---|
| PubChem CID | 59100938 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (2S)-2-[[(1R)-1-carboxy-3-phenylpropyl]amino]-5-pyridin-2-ylpent-4-ynoic acid |
| SMILES | O=C(O)[C@H](CC#Cc1ccccn1)N[C@H](CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H20N2O4/c23-19(24)17(11-6-10-16-9-4-5-14-21-16)22-18(20(25)26)13-12-15-7-2-1-3-8-15/h1-5,7-9,14,17-18,22H,11-13H2,(H,23,24)(H,25,26)/t17-,18+/m0/s1 |
| InChIKey | GDOQJCQVZVGMBU-ZWKOTPCHSA-N |
| XLogP | 1.95 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|