C26H27NO4 — CID 15228253
(2S)-2-[[(2S)-1-oxo-4-phenyl-1-phenylmethoxybutan-2-yl]amino]-3-phenylpropanoic acid (PubChem CID 15228253) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-oxo-4-phenyl-1-phenylmethoxybutan-2-yl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-oxo-4-phenyl-1-phenylmethoxybutan-2-yl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 15228253 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (2S)-2-[[(2S)-1-oxo-4-phenyl-1-phenylmethoxybutan-2-yl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccccc1)N[C@@H](CCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H27NO4/c28-25(29)24(18-21-12-6-2-7-13-21)27-23(17-16-20-10-4-1-5-11-20)26(30)31-19-22-14-8-3-9-15-22/h1-15,23-24,27H,16-19H2,(H,28,29)/t23-,24-/m0/s1 |
| InChIKey | NFKRLTNUTLMUBN-ZEQRLZLVSA-N |
| XLogP | 4.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |