C18H19F2NO2 — CID 175725657
benzyl (2S)-2-(difluoromethylamino)-4-phenylbutanoate (PubChem CID 175725657) has the molecular formula C18H19F2NO2 and a molecular weight of 319.35 g/mol. Its IUPAC name is benzyl (2S)-2-(difluoromethylamino)-4-phenylbutanoate.
| Compound Name | benzyl (2S)-2-(difluoromethylamino)-4-phenylbutanoate |
|---|---|
| PubChem CID | 175725657 |
| Molecular Formula | C18H19F2NO2 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | benzyl (2S)-2-(difluoromethylamino)-4-phenylbutanoate |
| SMILES | O=C(OCc1ccccc1)[C@H](CCc1ccccc1)NC(F)F |
| InChI | InChI=1S/C18H19F2NO2/c19-18(20)21-16(12-11-14-7-3-1-4-8-14)17(22)23-13-15-9-5-2-6-10-15/h1-10,16,18,21H,11-13H2/t16-/m0/s1 |
| InChIKey | BBZRZESHVFKMNW-INIZCTEOSA-N |
| XLogP | 3.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|