C24H22O — CID 59101854
2,3,7-trimethyl-6-methylidene-9-(2-methylphenyl)xanthene (PubChem CID 59101854) has the molecular formula C24H22O and a molecular weight of 326.44 g/mol. Its IUPAC name is 2,3,7-trimethyl-6-methylidene-9-(2-methylphenyl)xanthene.
| Compound Name | 2,3,7-trimethyl-6-methylidene-9-(2-methylphenyl)xanthene |
|---|---|
| PubChem CID | 59101854 |
| Molecular Formula | C24H22O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2,3,7-trimethyl-6-methylidene-9-(2-methylphenyl)xanthene |
| SMILES | C=c1cc2c(cc1C)=C(c1ccccc1C)c1cc(C)c(C)cc1O2 |
| InChI | InChI=1S/C24H22O/c1-14-8-6-7-9-19(14)24-20-10-15(2)17(4)12-22(20)25-23-13-18(5)16(3)11-21(23)24/h6-13H,4H2,1-3,5H3 |
| InChIKey | QRVPUPNSTYOEGX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |