C22H6O6S — CID 59101964
3-sulfino-5-tetradeca-1,3,5,7,9,11,13-heptaynoxycarbonylbenzoic acid (PubChem CID 59101964) has the molecular formula C22H6O6S and a molecular weight of 398.35 g/mol. Its IUPAC name is 3-sulfino-5-tetradeca-1,3,5,7,9,11,13-heptaynoxycarbonylbenzoic acid.
| Compound Name | 3-sulfino-5-tetradeca-1,3,5,7,9,11,13-heptaynoxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 59101964 |
| Molecular Formula | C22H6O6S |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | 3-sulfino-5-tetradeca-1,3,5,7,9,11,13-heptaynoxycarbonylbenzoic acid |
| SMILES | C#CC#CC#CC#CC#CC#CC#COC(=O)c1cc(C(=O)O)cc(S(=O)O)c1 |
| InChI | InChI=1S/C22H6O6S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-28-22(25)19-15-18(21(23)24)16-20(17-19)29(26)27/h1,15-17H,(H,23,24)(H,26,27) |
| InChIKey | YDFVHTJOIBNBET-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|