C23H36BN5O12 — CID 59103574
(2S)-6-[[(4S)-4-[(3-borono-5-nitrobenzoyl)amino]-5-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-oxopentanoyl]amino]-2-(methylamino)hexanoic acid (PubChem CID 59103574) has the molecular formula C23H36BN5O12 and a molecular weight of 585.38 g/mol. Its IUPAC name is (2S)-6-[[(4S)-4-[(3-borono-5-nitrobenzoyl)amino]-5-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-oxopentanoyl]amino]-2-(methylamino)hexanoic acid.
| Compound Name | (2S)-6-[[(4S)-4-[(3-borono-5-nitrobenzoyl)amino]-5-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-oxopentanoyl]amino]-2-(methylamino)hexanoic acid |
|---|---|
| PubChem CID | 59103574 |
| Molecular Formula | C23H36BN5O12 |
| Molecular Weight | 585.38 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | (2S)-6-[[(4S)-4-[(3-borono-5-nitrobenzoyl)amino]-5-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-oxopentanoyl]amino]-2-(methylamino)hexanoic acid |
| SMILES | CN[C@@H](CCCCNC(=O)CC[C@H](NC(=O)c1cc(B(O)O)cc([N+](=O)[O-])c1)C(=O)NC(CO)(CO)CO)C(=O)O |
| InChI | InChI=1S/C23H36BN5O12/c1-25-18(22(36)37)4-2-3-7-26-19(33)6-5-17(21(35)28-23(11-30,12-31)13-32)27-20(34)14-8-15(24(38)39)10-16(9-14)29(40)41/h8-10,17-18,25,30-32,38-39H,2-7,11-13H2,1H3,(H,26,33)(H,27,34)(H,28,35)(H,36,37)/t17-,18-/m0/s1 |
| InChIKey | WXSXQXMTLYPQNR-ROUUACIJSA-N |
| XLogP | -4.06 |
| TPSA | 280.92 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.38 |
| LogP ≤ 5 | -4.06 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|