C22H25BN6O12 — CID 59903612
(2S)-2-[(3-borono-5-nitrobenzoyl)amino]-6-[[4-(dimethylamino)-3,5-dinitrobenzoyl]amino]hexanoic acid (PubChem CID 59903612) has the molecular formula C22H25BN6O12 and a molecular weight of 576.28 g/mol. Its IUPAC name is (2S)-2-[(3-borono-5-nitrobenzoyl)amino]-6-[[4-(dimethylamino)-3,5-dinitrobenzoyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[(3-borono-5-nitrobenzoyl)amino]-6-[[4-(dimethylamino)-3,5-dinitrobenzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 59903612 |
| Molecular Formula | C22H25BN6O12 |
| Molecular Weight | 576.28 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | (2S)-2-[(3-borono-5-nitrobenzoyl)amino]-6-[[4-(dimethylamino)-3,5-dinitrobenzoyl]amino]hexanoic acid |
| SMILES | CN(C)c1c([N+](=O)[O-])cc(C(=O)NCCCC[C@H](NC(=O)c2cc(B(O)O)cc([N+](=O)[O-])c2)C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H25BN6O12/c1-26(2)19-17(28(38)39)9-13(10-18(19)29(40)41)20(30)24-6-4-3-5-16(22(32)33)25-21(31)12-7-14(23(34)35)11-15(8-12)27(36)37/h7-11,16,34-35H,3-6H2,1-2H3,(H,24,30)(H,25,31)(H,32,33)/t16-/m0/s1 |
| InChIKey | PDOGAJMGUVLPDQ-INIZCTEOSA-N |
| XLogP | -0.06 |
| TPSA | 268.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.28 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|