C23H27BN6O12 — CID 59903591
[3-[[6-[[4-(dimethylamino)-3,5-dinitrobenzoyl]amino]-1-methoxy-1-oxohexan-2-yl]carbamoyl]-5-nitrophenyl]boronic acid (PubChem CID 59903591) has the molecular formula C23H27BN6O12 and a molecular weight of 590.31 g/mol. Its IUPAC name is [3-[[6-[[4-(dimethylamino)-3,5-dinitrobenzoyl]amino]-1-methoxy-1-oxohexan-2-yl]carbamoyl]-5-nitrophenyl]boronic acid.
| Compound Name | [3-[[6-[[4-(dimethylamino)-3,5-dinitrobenzoyl]amino]-1-methoxy-1-oxohexan-2-yl]carbamoyl]-5-nitrophenyl]boronic acid |
|---|---|
| PubChem CID | 59903591 |
| Molecular Formula | C23H27BN6O12 |
| Molecular Weight | 590.31 g/mol |
| Exact Mass | 590.18 |
| IUPAC Name | [3-[[6-[[4-(dimethylamino)-3,5-dinitrobenzoyl]amino]-1-methoxy-1-oxohexan-2-yl]carbamoyl]-5-nitrophenyl]boronic acid |
| SMILES | COC(=O)C(CCCCNC(=O)c1cc([N+](=O)[O-])c(N(C)C)c([N+](=O)[O-])c1)NC(=O)c1cc(B(O)O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H27BN6O12/c1-27(2)20-18(29(38)39)10-14(11-19(20)30(40)41)21(31)25-7-5-4-6-17(23(33)42-3)26-22(32)13-8-15(24(34)35)12-16(9-13)28(36)37/h8-12,17,34-35H,4-7H2,1-3H3,(H,25,31)(H,26,32) |
| InChIKey | KPOLYCLJOSJGSK-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 257.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|