C11H20BNO6 — CID 59107462
CID 59107462 (PubChem CID 59107462) has the molecular formula C11H20BNO6 and a molecular weight of 273.09 g/mol.
| Compound Name | CID 59107462 |
|---|---|
| PubChem CID | 59107462 |
| Molecular Formula | C11H20BNO6 |
| Molecular Weight | 273.09 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | — |
| SMILES | [B]C(=O)NCCOCCOCCOC(=O)OCCC |
| InChI | InChI=1S/C11H20BNO6/c1-2-4-18-11(15)19-9-8-17-7-6-16-5-3-13-10(12)14/h2-9H2,1H3,(H,13,14) |
| InChIKey | VCDDYRQGPUCHJZ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.09 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|