C15H38O3Si4 — CID 59107516
CID 59107516 (PubChem CID 59107516) has the molecular formula C15H38O3Si4 and a molecular weight of 378.81 g/mol.
| Compound Name | CID 59107516 |
|---|---|
| PubChem CID | 59107516 |
| Molecular Formula | C15H38O3Si4 |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | — |
| SMILES | CCC(C)(OO[Si](C)(C)CC)[Si]C[Si](C)(C)O[Si](C)(C)CC |
| InChI | InChI=1S/C15H38O3Si4/c1-11-15(4,16-17-20(5,6)12-2)19-14-22(9,10)18-21(7,8)13-3/h11-14H2,1-10H3 |
| InChIKey | TWGHPDBDQZENBZ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|