C10H17Cl2NO — CID 59109322
N-butyl-2,2-dichloro-1,3-dimethylcyclopropane-1-carboxamide (PubChem CID 59109322) has the molecular formula C10H17Cl2NO and a molecular weight of 238.16 g/mol. Its IUPAC name is N-butyl-2,2-dichloro-1,3-dimethylcyclopropane-1-carboxamide.
| Compound Name | N-butyl-2,2-dichloro-1,3-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 59109322 |
| Molecular Formula | C10H17Cl2NO |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | N-butyl-2,2-dichloro-1,3-dimethylcyclopropane-1-carboxamide |
| SMILES | CCCCNC(=O)C1(C)C(C)C1(Cl)Cl |
| InChI | InChI=1S/C10H17Cl2NO/c1-4-5-6-13-8(14)9(3)7(2)10(9,11)12/h7H,4-6H2,1-3H3,(H,13,14) |
| InChIKey | CLCLMEMMKZBTGB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|