C20H29F3N6O3 — CID 59110144
(2R)-1-N-cyclohexyl-2-N-(3-imidazol-1-ylpropyl)-4-(2,2,2-trifluoroacetyl)piperazine-1,2-dicarboxamide (PubChem CID 59110144) has the molecular formula C20H29F3N6O3 and a molecular weight of 458.49 g/mol. Its IUPAC name is (2R)-1-N-cyclohexyl-2-N-(3-imidazol-1-ylpropyl)-4-(2,2,2-trifluoroacetyl)piperazine-1,2-dicarboxamide.
| Compound Name | (2R)-1-N-cyclohexyl-2-N-(3-imidazol-1-ylpropyl)-4-(2,2,2-trifluoroacetyl)piperazine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 59110144 |
| Molecular Formula | C20H29F3N6O3 |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | (2R)-1-N-cyclohexyl-2-N-(3-imidazol-1-ylpropyl)-4-(2,2,2-trifluoroacetyl)piperazine-1,2-dicarboxamide |
| SMILES | O=C(NCCCn1ccnc1)[C@H]1CN(C(=O)C(F)(F)F)CCN1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C20H29F3N6O3/c21-20(22,23)18(31)28-11-12-29(19(32)26-15-5-2-1-3-6-15)16(13-28)17(30)25-7-4-9-27-10-8-24-14-27/h8,10,14-16H,1-7,9,11-13H2,(H,25,30)(H,26,32)/t16-/m1/s1 |
| InChIKey | CQYGCABYWZNVEW-MRXNPFEDSA-N |
| XLogP | 1.51 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|