C18H18N2O — CID 59110393
5-amino-1,7-dimethyl-3-(4-methylphenyl)quinolin-4-one (PubChem CID 59110393) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is 5-amino-1,7-dimethyl-3-(4-methylphenyl)quinolin-4-one.
| Compound Name | 5-amino-1,7-dimethyl-3-(4-methylphenyl)quinolin-4-one |
|---|---|
| PubChem CID | 59110393 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 5-amino-1,7-dimethyl-3-(4-methylphenyl)quinolin-4-one |
| SMILES | Cc1ccc(-c2cn(C)c3cc(C)cc(N)c3c2=O)cc1 |
| InChI | InChI=1S/C18H18N2O/c1-11-4-6-13(7-5-11)14-10-20(3)16-9-12(2)8-15(19)17(16)18(14)21/h4-10H,19H2,1-3H3 |
| InChIKey | XYMMVHGNYKTDGT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|