C17H14BrNO — CID 166443946
3-(4-bromophenyl)-1,6-dimethylquinolin-4-one (PubChem CID 166443946) has the molecular formula C17H14BrNO and a molecular weight of 328.21 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1,6-dimethylquinolin-4-one.
| Compound Name | 3-(4-bromophenyl)-1,6-dimethylquinolin-4-one |
|---|---|
| PubChem CID | 166443946 |
| Molecular Formula | C17H14BrNO |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 3-(4-bromophenyl)-1,6-dimethylquinolin-4-one |
| SMILES | Cc1ccc2c(c1)c(=O)c(-c1ccc(Br)cc1)cn2C |
| InChI | InChI=1S/C17H14BrNO/c1-11-3-8-16-14(9-11)17(20)15(10-19(16)2)12-4-6-13(18)7-5-12/h3-10H,1-2H3 |
| InChIKey | LWUQTCVETUJJDT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |