C13H22N2O2 — CID 59110997
3-(5,5-dimethylhexyl)-1-ethenylimidazolidine-2,4-dione (PubChem CID 59110997) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 3-(5,5-dimethylhexyl)-1-ethenylimidazolidine-2,4-dione.
| Compound Name | 3-(5,5-dimethylhexyl)-1-ethenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59110997 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 3-(5,5-dimethylhexyl)-1-ethenylimidazolidine-2,4-dione |
| SMILES | C=CN1CC(=O)N(CCCCC(C)(C)C)C1=O |
| InChI | InChI=1S/C13H22N2O2/c1-5-14-10-11(16)15(12(14)17)9-7-6-8-13(2,3)4/h5H,1,6-10H2,2-4H3 |
| InChIKey | ZNATWFFYOHFFFE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|