C13H7FN4 — CID 59113303
13-fluoro-2,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,12,14,16-octaene (PubChem CID 59113303) has the molecular formula C13H7FN4 and a molecular weight of 238.23 g/mol. Its IUPAC name is 13-fluoro-2,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,12,14,16-octaene.
| Compound Name | 13-fluoro-2,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,12,14,16-octaene |
|---|---|
| PubChem CID | 59113303 |
| Molecular Formula | C13H7FN4 |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 13-fluoro-2,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,12,14,16-octaene |
| SMILES | Fc1ccc2nc3nc4ccccc4nc3n2c1 |
| InChI | InChI=1S/C13H7FN4/c14-8-5-6-11-17-12-13(18(11)7-8)16-10-4-2-1-3-9(10)15-12/h1-7H |
| InChIKey | GEUVILQGGLJFRC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |