C13H7N5O2 — CID 10967410
6-nitro-2,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,12,14,16-octaene (PubChem CID 10967410) has the molecular formula C13H7N5O2 and a molecular weight of 265.23 g/mol. Its IUPAC name is 6-nitro-2,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,12,14,16-octaene.
| Compound Name | 6-nitro-2,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,12,14,16-octaene |
|---|---|
| PubChem CID | 10967410 |
| Molecular Formula | C13H7N5O2 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 6-nitro-2,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,12,14,16-octaene |
| SMILES | O=[N+]([O-])c1ccc2nc3nc4ccccn4c3nc2c1 |
| InChI | InChI=1S/C13H7N5O2/c19-18(20)8-4-5-9-10(7-8)15-13-12(14-9)16-11-3-1-2-6-17(11)13/h1-7H |
| InChIKey | DTLHXNRHZUDNHS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|