C20H12N4O — CID 14572739
phenyl(2,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,12,14,16-octaen-14-yl)methanone (PubChem CID 14572739) has the molecular formula C20H12N4O and a molecular weight of 324.34 g/mol. Its IUPAC name is phenyl(2,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,12,14,16-octaen-14-yl)methanone.
| Compound Name | phenyl(2,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,12,14,16-octaen-14-yl)methanone |
|---|---|
| PubChem CID | 14572739 |
| Molecular Formula | C20H12N4O |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | phenyl(2,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,12,14,16-octaen-14-yl)methanone |
| SMILES | O=C(c1ccccc1)c1ccn2c(c1)nc1nc3ccccc3nc12 |
| InChI | InChI=1S/C20H12N4O/c25-18(13-6-2-1-3-7-13)14-10-11-24-17(12-14)23-19-20(24)22-16-9-5-4-8-15(16)21-19/h1-12H |
| InChIKey | VCPWSVNFRXVGAG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |