C32H38F3NO7S2 — CID 59115202
[4-[[1-(4-butan-2-yloxy-2,3-dimethylphenyl)-2,2,2-trifluoroethylidene]amino]oxysulfonyl-2,3-dimethylphenyl] 4-ethyl-2,3-dimethylbenzenesulfonate (PubChem CID 59115202) has the molecular formula C32H38F3NO7S2 and a molecular weight of 669.78 g/mol. Its IUPAC name is [4-[[1-(4-butan-2-yloxy-2,3-dimethylphenyl)-2,2,2-trifluoroethylidene]amino]oxysulfonyl-2,3-dimethylphenyl] 4-ethyl-2,3-dimethylbenzenesulfonate.
| Compound Name | [4-[[1-(4-butan-2-yloxy-2,3-dimethylphenyl)-2,2,2-trifluoroethylidene]amino]oxysulfonyl-2,3-dimethylphenyl] 4-ethyl-2,3-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 59115202 |
| Molecular Formula | C32H38F3NO7S2 |
| Molecular Weight | 669.78 g/mol |
| Exact Mass | 669.20 |
| IUPAC Name | [4-[[1-(4-butan-2-yloxy-2,3-dimethylphenyl)-2,2,2-trifluoroethylidene]amino]oxysulfonyl-2,3-dimethylphenyl] 4-ethyl-2,3-dimethylbenzenesulfonate |
| SMILES | CCc1ccc(S(=O)(=O)Oc2ccc(S(=O)(=O)ON=C(c3ccc(OC(C)CC)c(C)c3C)C(F)(F)F)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C32H38F3NO7S2/c1-10-18(3)41-27-14-13-26(20(5)21(27)6)31(32(33,34)35)36-43-45(39,40)30-17-15-28(22(7)24(30)9)42-44(37,38)29-16-12-25(11-2)19(4)23(29)8/h12-18H,10-11H2,1-9H3 |
| InChIKey | PMKGKDYBXFFNKN-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 108.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.78 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|