C26H20F3NO7S2 — CID 59115149
[[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino] 6-(4-methylphenyl)sulfonyloxynaphthalene-2-sulfonate (PubChem CID 59115149) has the molecular formula C26H20F3NO7S2 and a molecular weight of 579.57 g/mol. Its IUPAC name is [[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino] 6-(4-methylphenyl)sulfonyloxynaphthalene-2-sulfonate.
| Compound Name | [[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino] 6-(4-methylphenyl)sulfonyloxynaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 59115149 |
| Molecular Formula | C26H20F3NO7S2 |
| Molecular Weight | 579.57 g/mol |
| Exact Mass | 579.06 |
| IUPAC Name | [[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino] 6-(4-methylphenyl)sulfonyloxynaphthalene-2-sulfonate |
| SMILES | COc1ccc(C(=NOS(=O)(=O)c2ccc3cc(OS(=O)(=O)c4ccc(C)cc4)ccc3c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H20F3NO7S2/c1-17-3-12-23(13-4-17)38(31,32)36-22-11-7-20-16-24(14-8-19(20)15-22)39(33,34)37-30-25(26(27,28)29)18-5-9-21(35-2)10-6-18/h3-16H,1-2H3 |
| InChIKey | ZBFCHCONBZWXPX-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 108.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.57 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|