C21H18F3NO6S2 — CID 23591334
[(Z)-[2,2,2-trifluoro-1-[4-(2-methylsulfonylethoxy)phenyl]ethylidene]amino] naphthalene-2-sulfonate (PubChem CID 23591334) has the molecular formula C21H18F3NO6S2 and a molecular weight of 501.50 g/mol. Its IUPAC name is [(Z)-[2,2,2-trifluoro-1-[4-(2-methylsulfonylethoxy)phenyl]ethylidene]amino] naphthalene-2-sulfonate.
| Compound Name | [(Z)-[2,2,2-trifluoro-1-[4-(2-methylsulfonylethoxy)phenyl]ethylidene]amino] naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 23591334 |
| Molecular Formula | C21H18F3NO6S2 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.05 |
| IUPAC Name | [(Z)-[2,2,2-trifluoro-1-[4-(2-methylsulfonylethoxy)phenyl]ethylidene]amino] naphthalene-2-sulfonate |
| SMILES | CS(=O)(=O)CCOc1ccc(/C(=N/OS(=O)(=O)c2ccc3ccccc3c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H18F3NO6S2/c1-32(26,27)13-12-30-18-9-6-16(7-10-18)20(21(22,23)24)25-31-33(28,29)19-11-8-15-4-2-3-5-17(15)14-19/h2-11,14H,12-13H2,1H3/b25-20- |
| InChIKey | PKNIOTGJMZVBTE-QQTULTPQSA-N |
| XLogP | 3.94 |
| TPSA | 99.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|