C23H21F3NO4S2+ — CID 23591348
2-[4-[(Z)-N-methylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethyl-diphenylsulfanium (PubChem CID 23591348) has the molecular formula C23H21F3NO4S2+ and a molecular weight of 496.55 g/mol. Its IUPAC name is 2-[4-[(Z)-N-methylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethyl-diphenylsulfanium.
| Compound Name | 2-[4-[(Z)-N-methylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethyl-diphenylsulfanium |
|---|---|
| PubChem CID | 23591348 |
| Molecular Formula | C23H21F3NO4S2+ |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 2-[4-[(Z)-N-methylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethyl-diphenylsulfanium |
| SMILES | CS(=O)(=O)O/N=C(/c1ccc(OCC[S+](c2ccccc2)c2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C23H21F3NO4S2/c1-33(28,29)31-27-22(23(24,25)26)18-12-14-19(15-13-18)30-16-17-32(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-15H,16-17H2,1H3/q+1/b27-22- |
| InChIKey | IPQCWQIUPNTRKE-QYQHSDTDSA-N |
| XLogP | 5.04 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|