C20H15F3NO7S2- — CID 58616586
2-[4-[(Z)-N-naphthalen-2-ylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethanesulfonate (PubChem CID 58616586) has the molecular formula C20H15F3NO7S2- and a molecular weight of 502.47 g/mol. Its IUPAC name is 2-[4-[(Z)-N-naphthalen-2-ylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethanesulfonate.
| Compound Name | 2-[4-[(Z)-N-naphthalen-2-ylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethanesulfonate |
|---|---|
| PubChem CID | 58616586 |
| Molecular Formula | C20H15F3NO7S2- |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | 2-[4-[(Z)-N-naphthalen-2-ylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethanesulfonate |
| SMILES | O=S(=O)([O-])CCOc1ccc(/C(=N/OS(=O)(=O)c2ccc3ccccc3c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H16F3NO7S2/c21-20(22,23)19(15-5-8-17(9-6-15)30-11-12-32(25,26)27)24-31-33(28,29)18-10-7-14-3-1-2-4-16(14)13-18/h1-10,13H,11-12H2,(H,25,26,27)/p-1/b24-19- |
| InChIKey | ANQGYWPJEQNXPH-CLCOLTQESA-M |
| XLogP | 3.44 |
| TPSA | 122.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|