C12H22N2OS — CID 59116061
(3aR,6S)-N-tert-butyl-2,3,3a,4,5,6,7,7a-octahydrothieno[3,2-c]pyridine-6-carboxamide (PubChem CID 59116061) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is (3aR,6S)-N-tert-butyl-2,3,3a,4,5,6,7,7a-octahydrothieno[3,2-c]pyridine-6-carboxamide.
| Compound Name | (3aR,6S)-N-tert-butyl-2,3,3a,4,5,6,7,7a-octahydrothieno[3,2-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 59116061 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (3aR,6S)-N-tert-butyl-2,3,3a,4,5,6,7,7a-octahydrothieno[3,2-c]pyridine-6-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@@H]1CC2SCC[C@@H]2CN1 |
| InChI | InChI=1S/C12H22N2OS/c1-12(2,3)14-11(15)9-6-10-8(7-13-9)4-5-16-10/h8-10,13H,4-7H2,1-3H3,(H,14,15)/t8-,9+,10?/m1/s1 |
| InChIKey | ZGYHRQYSVOFYFQ-ZDGBYWQASA-N |
| XLogP | 1.38 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |