C12H18N2OW — CID 59117159
carbanide;3-(piperidin-4-id-1-ylmethyl)-1H-pyridin-2-one;tungsten(2+) (PubChem CID 59117159) has the molecular formula C12H18N2OW and a molecular weight of 390.13 g/mol. Its IUPAC name is carbanide;3-(piperidin-4-id-1-ylmethyl)-1H-pyridin-2-one;tungsten(2+).
| Compound Name | carbanide;3-(piperidin-4-id-1-ylmethyl)-1H-pyridin-2-one;tungsten(2+) |
|---|---|
| PubChem CID | 59117159 |
| Molecular Formula | C12H18N2OW |
| Molecular Weight | 390.13 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | carbanide;3-(piperidin-4-id-1-ylmethyl)-1H-pyridin-2-one;tungsten(2+) |
| SMILES | O=c1[nH]cccc1CN1CC[CH-]CC1.[CH3-].[W+2] |
| InChI | InChI=1S/C11H15N2O.CH3.W/c14-11-10(5-4-6-12-11)9-13-7-2-1-3-8-13;;/h1,4-6H,2-3,7-9H2,(H,12,14);1H3;/q2*-1;+2 |
| InChIKey | WHOXJQYKVNECGC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.13 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|