C23H31N3O4 — CID 59117554
(2S,3R)-N-hydroxy-N'-[(2S)-1-(1H-indol-3-yl)-1-oxobutan-2-yl]-3-(2-methylpropyl)-2-prop-2-enylbutanediamide (PubChem CID 59117554) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is (2S,3R)-N-hydroxy-N'-[(2S)-1-(1H-indol-3-yl)-1-oxobutan-2-yl]-3-(2-methylpropyl)-2-prop-2-enylbutanediamide.
| Compound Name | (2S,3R)-N-hydroxy-N'-[(2S)-1-(1H-indol-3-yl)-1-oxobutan-2-yl]-3-(2-methylpropyl)-2-prop-2-enylbutanediamide |
|---|---|
| PubChem CID | 59117554 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | (2S,3R)-N-hydroxy-N'-[(2S)-1-(1H-indol-3-yl)-1-oxobutan-2-yl]-3-(2-methylpropyl)-2-prop-2-enylbutanediamide |
| SMILES | C=CCC(C(=O)NO)[C@@H](CC(C)C)C(=O)N[C@@H](CC)C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H31N3O4/c1-5-9-16(23(29)26-30)17(12-14(3)4)22(28)25-19(6-2)21(27)18-13-24-20-11-8-7-10-15(18)20/h5,7-8,10-11,13-14,16-17,19,24,30H,1,6,9,12H2,2-4H3,(H,25,28)(H,26,29)/t16?,17-,19+/m1/s1 |
| InChIKey | VFMLNQYQCGGWRR-QIONWKSUSA-N |
| XLogP | 3.61 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|