C10H11O2Y- — CID 59118209
2,3,4,6-tetrahydrochromen-6-id-2-ylmethanol;yttrium (PubChem CID 59118209) has the molecular formula C10H11O2Y- and a molecular weight of 252.10 g/mol. Its IUPAC name is 2,3,4,6-tetrahydrochromen-6-id-2-ylmethanol;yttrium.
| Compound Name | 2,3,4,6-tetrahydrochromen-6-id-2-ylmethanol;yttrium |
|---|---|
| PubChem CID | 59118209 |
| Molecular Formula | C10H11O2Y- |
| Molecular Weight | 252.10 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | 2,3,4,6-tetrahydrochromen-6-id-2-ylmethanol;yttrium |
| SMILES | OCC1CCc2c[c-]ccc2O1.[Y] |
| InChI | InChI=1S/C10H11O2.Y/c11-7-9-6-5-8-3-1-2-4-10(8)12-9;/h2-4,9,11H,5-7H2;/q-1; |
| InChIKey | HMCBQBPHUGNAOK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.10 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|