C9H9O2Y- — CID 59106147
3,5-dihydro-2H-1-benzofuran-5-id-2-ylmethanol;yttrium (PubChem CID 59106147) has the molecular formula C9H9O2Y- and a molecular weight of 238.07 g/mol. Its IUPAC name is 3,5-dihydro-2H-1-benzofuran-5-id-2-ylmethanol;yttrium.
| Compound Name | 3,5-dihydro-2H-1-benzofuran-5-id-2-ylmethanol;yttrium |
|---|---|
| PubChem CID | 59106147 |
| Molecular Formula | C9H9O2Y- |
| Molecular Weight | 238.07 g/mol |
| Exact Mass | 237.97 |
| IUPAC Name | 3,5-dihydro-2H-1-benzofuran-5-id-2-ylmethanol;yttrium |
| SMILES | OCC1Cc2c[c-]ccc2O1.[Y] |
| InChI | InChI=1S/C9H9O2.Y/c10-6-8-5-7-3-1-2-4-9(7)11-8;/h2-4,8,10H,5-6H2;/q-1; |
| InChIKey | VGLXHNFJESJGJG-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.07 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|