C11H12BrO2Y- — CID 58999623
[(2R)-7-methyl-2,3,4,8-tetrahydrochromen-8-id-2-yl]methyl hypobromite;yttrium (PubChem CID 58999623) has the molecular formula C11H12BrO2Y- and a molecular weight of 345.03 g/mol. Its IUPAC name is [(2R)-7-methyl-2,3,4,8-tetrahydrochromen-8-id-2-yl]methyl hypobromite;yttrium.
| Compound Name | [(2R)-7-methyl-2,3,4,8-tetrahydrochromen-8-id-2-yl]methyl hypobromite;yttrium |
|---|---|
| PubChem CID | 58999623 |
| Molecular Formula | C11H12BrO2Y- |
| Molecular Weight | 345.03 g/mol |
| Exact Mass | 343.91 |
| IUPAC Name | [(2R)-7-methyl-2,3,4,8-tetrahydrochromen-8-id-2-yl]methyl hypobromite;yttrium |
| SMILES | Cc1[c-]c2c(cc1)CC[C@H](COBr)O2.[Y] |
| InChI | InChI=1S/C11H12BrO2.Y/c1-8-2-3-9-4-5-10(7-13-12)14-11(9)6-8;/h2-3,10H,4-5,7H2,1H3;/q-1;/t10-;/m1./s1 |
| InChIKey | BWSLKZIWAABMNO-HNCPQSOCSA-N |
| XLogP | 2.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.03 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|