C14H17OY- — CID 59215295
7,8-dimethyl-2-[(E)-prop-1-enyl]-2,3,4,6-tetrahydrochromen-6-ide;yttrium (PubChem CID 59215295) has the molecular formula C14H17OY- and a molecular weight of 290.20 g/mol. Its IUPAC name is 7,8-dimethyl-2-[(E)-prop-1-enyl]-2,3,4,6-tetrahydrochromen-6-ide;yttrium.
| Compound Name | 7,8-dimethyl-2-[(E)-prop-1-enyl]-2,3,4,6-tetrahydrochromen-6-ide;yttrium |
|---|---|
| PubChem CID | 59215295 |
| Molecular Formula | C14H17OY- |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 7,8-dimethyl-2-[(E)-prop-1-enyl]-2,3,4,6-tetrahydrochromen-6-ide;yttrium |
| SMILES | C/C=C/C1CCc2c[c-]c(C)c(C)c2O1.[Y] |
| InChI | InChI=1S/C14H17O.Y/c1-4-5-13-9-8-12-7-6-10(2)11(3)14(12)15-13;/h4-5,7,13H,8-9H2,1-3H3;/q-1;/b5-4+; |
| InChIKey | TVYCYEPWWPBTAN-FXRZFVDSSA-N |
| XLogP | 3.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|