C13H19FO — CID 123440132
6-(2-ethyl-1-fluorobuta-1,3-dienyl)-2,5-dimethyl-3,4-dihydro-2H-pyran (PubChem CID 123440132) has the molecular formula C13H19FO and a molecular weight of 210.29 g/mol. Its IUPAC name is 6-(2-ethyl-1-fluorobuta-1,3-dienyl)-2,5-dimethyl-3,4-dihydro-2H-pyran.
| Compound Name | 6-(2-ethyl-1-fluorobuta-1,3-dienyl)-2,5-dimethyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 123440132 |
| Molecular Formula | C13H19FO |
| Molecular Weight | 210.29 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 6-(2-ethyl-1-fluorobuta-1,3-dienyl)-2,5-dimethyl-3,4-dihydro-2H-pyran |
| SMILES | C=CC(CC)=C(F)C1=C(C)CCC(C)O1 |
| InChI | InChI=1S/C13H19FO/c1-5-11(6-2)12(14)13-9(3)7-8-10(4)15-13/h5,10H,1,6-8H2,2-4H3 |
| InChIKey | SZGYAHZNEVMOPL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|