C13H17FO2 — CID 57051616
(5R)-8-fluoro-5-methoxy-2,2,4-trimethyl-5,6-dihydrochromene (PubChem CID 57051616) has the molecular formula C13H17FO2 and a molecular weight of 224.27 g/mol. Its IUPAC name is (5R)-8-fluoro-5-methoxy-2,2,4-trimethyl-5,6-dihydrochromene.
| Compound Name | (5R)-8-fluoro-5-methoxy-2,2,4-trimethyl-5,6-dihydrochromene |
|---|---|
| PubChem CID | 57051616 |
| Molecular Formula | C13H17FO2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (5R)-8-fluoro-5-methoxy-2,2,4-trimethyl-5,6-dihydrochromene |
| SMILES | CO[C@@H]1CC=C(F)C2=C1C(C)=CC(C)(C)O2 |
| InChI | InChI=1S/C13H17FO2/c1-8-7-13(2,3)16-12-9(14)5-6-10(15-4)11(8)12/h5,7,10H,6H2,1-4H3/t10-/m1/s1 |
| InChIKey | VPDVMBSXWCMVIZ-SNVBAGLBSA-N |
| XLogP | 3.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |