About 2-fluoro-3,5-dimethoxy-1-methylcyclohexa-1,3-diene
2-fluoro-3,5-dimethoxy-1-methylcyclohexa-1,3-diene (PubChem CID 163789639) has the molecular formula C9H13FO2
and a molecular weight of 172.20 g/mol. Its IUPAC name is 2-fluoro-3,5-dimethoxy-1-methylcyclohexa-1,3-diene.
Analyze 2-fluoro-3,5-dimethoxy-1-methylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3,5-dimethoxy-1-methylcyclohexa-1,3-diene?
The IUPAC name of 2-fluoro-3,5-dimethoxy-1-methylcyclohexa-1,3-diene (CID 163789639) is 2-fluoro-3,5-dimethoxy-1-methylcyclohexa-1,3-diene.
What is the SMILES notation for 2-fluoro-3,5-dimethoxy-1-methylcyclohexa-1,3-diene?
The canonical SMILES for 2-fluoro-3,5-dimethoxy-1-methylcyclohexa-1,3-diene is COC1=CC(OC)CC(C)=C1F.
What is the InChIKey of 2-fluoro-3,5-dimethoxy-1-methylcyclohexa-1,3-diene?
The InChIKey is MVNYUBMJBPVVLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13FO2/c1-6-4-7(11-2)5-8(12-3)9(6)10/h5,7H,4H2,1-3H3.
What are the key properties of 2-fluoro-3,5-dimethoxy-1-methylcyclohexa-1,3-diene?
2-fluoro-3,5-dimethoxy-1-methylcyclohexa-1,3-diene has a molecular weight of 172.20 g/mol, XLogP of 2.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3,5-dimethoxy-1-methylcyclohexa-1,3-diene is sourced from PubChem (CID 163789639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).