C11H18NO+ — CID 59124055
1-(4-hydroxy-2,6-dimethylphenyl)propan-2-ylazanium (PubChem CID 59124055) has the molecular formula C11H18NO+ and a molecular weight of 180.27 g/mol. Its IUPAC name is 1-(4-hydroxy-2,6-dimethylphenyl)propan-2-ylazanium.
| Compound Name | 1-(4-hydroxy-2,6-dimethylphenyl)propan-2-ylazanium |
|---|---|
| PubChem CID | 59124055 |
| Molecular Formula | C11H18NO+ |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 1-(4-hydroxy-2,6-dimethylphenyl)propan-2-ylazanium |
| SMILES | Cc1cc(O)cc(C)c1CC(C)[NH3+] |
| InChI | InChI=1S/C11H17NO/c1-7-4-10(13)5-8(2)11(7)6-9(3)12/h4-5,9,13H,6,12H2,1-3H3/p+1 |
| InChIKey | SIFIWPHFRPZSNY-UHFFFAOYSA-O |
| XLogP | 1.18 |
| TPSA | 47.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |